CAS 1335042-15-3

1,1-Dimethylethyl N-[1-(2-amino-2-oxoethyl)-2-propen-1-yl]carbamate

Description:

1,1-Dimethylethyl N-[1-(2-amino-2-oxoethyl)-2-propen-1-yl]carbamate, identified by its CAS number 1335042-15-3, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N). This compound is likely to exhibit properties typical of carbamates, such as being a potential inhibitor of certain enzymes or acting as a herbicide or pesticide, depending on its specific structure and substituents. The presence of the dimethyl group suggests steric hindrance, which may influence its reactivity and interaction with biological systems. Additionally, the amino and propenyl groups indicate potential for further chemical reactivity, possibly allowing for conjugation or polymerization reactions. The compound's solubility, stability, and biological activity would depend on its molecular structure and the surrounding environment, including pH and temperature. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.

Formula: C₁₀H₁₈N₂O₃

InChI: InChI=1S/C10H18N2O3/c1-5-7(6-8(11)13)12-9(14)15-10(2,3)4/h5,7H,1,6H2,2-4H3,(H2,11,13)(H,12,14)

InChI key: InChIKey=JKAATTORSSOTFB-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(CC(N)=O)C=C

Synonyms:

• Carbamic acid, N-[1-(2-amino-2-oxoethyl)-2-propen-1-yl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[1-(2-amino-2-oxoethyl)-2-propen-1-yl]carbamate