CAS 1335042-66-4

1,1-Dimethylethyl N-[1-(2-propen-1-yl)hexyl]carbamate

Description:

1,1-Dimethylethyl N-[1-(2-propen-1-yl)hexyl]carbamate, identified by its CAS number 1335042-66-4, is an organic compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The compound exhibits a complex structure due to the presence of both a tert-butyl group (1,1-dimethylethyl) and a propenyl-hexyl substituent, contributing to its unique chemical properties. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. The presence of multiple functional groups suggests potential applications in various fields, including agriculture as a pesticide or herbicide, or in the synthesis of other organic compounds. As with many carbamates, it may exhibit biological activity, necessitating careful handling and consideration of its environmental impact.

Formula: C₁₄H₂₇NO₂

InChI: InChI=1S/C14H27NO2/c1-6-8-9-11-12(10-7-2)15-13(16)17-14(3,4)5/h7,12H,2,6,8-11H2,1,3-5H3,(H,15,16)

InChI key: InChIKey=FWJAMWBZEWWFLP-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(CCCCC)CC=C

Synonyms:

• 1,1-Dimethylethyl N-[1-(2-propen-1-yl)hexyl]carbamate
• Carbamic acid, N-[1-(2-propen-1-yl)hexyl]-, 1,1-dimethylethyl ester