CAS 1335042-79-9
:1,1-Dimethylethyl N-[1-(2-oxoethyl)cyclopentyl]carbamate
Description:
1,1-Dimethylethyl N-[1-(2-oxoethyl)cyclopentyl]carbamate, identified by its CAS number 1335042-79-9, is a chemical compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The compound exhibits a complex structure due to the presence of a cyclopentyl ring and an oxoethyl substituent, contributing to its potential biological activity. Typically, carbamates can exhibit a range of properties, including insecticidal or herbicidal activity, depending on their specific structure and substituents. The presence of the dimethyl group suggests steric hindrance, which may influence the compound's reactivity and interaction with biological targets. As with many organic compounds, the solubility, stability, and reactivity of this substance can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H21NO3
InChI:InChI=1S/C12H21NO3/c1-11(2,3)16-10(15)13-12(8-9-14)6-4-5-7-12/h9H,4-8H2,1-3H3,(H,13,15)
InChI key:InChIKey=HSQBQCLHVYUFBW-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1(CC=O)CCCC1
Synonyms:- Carbamic acid, N-[1-(2-oxoethyl)cyclopentyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[1-(2-oxoethyl)cyclopentyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.