CAS 1335050-24-2

7-Chloro-5-nitroisoquinoline

Description:

7-Chloro-5-nitroisoquinoline is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring. The presence of a chlorine atom at the 7-position and a nitro group at the 5-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The nitro group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the chlorine substituent can influence the compound's reactivity and solubility in different solvents. As with many nitro-containing compounds, 7-Chloro-5-nitroisoquinoline may exhibit specific toxicological properties, necessitating careful handling and assessment in laboratory settings. Overall, its structural features and functional groups make it an interesting subject of study in both synthetic and medicinal chemistry.

Formula: C₉H₅ClN₂O₂

InChI: InChI=1S/C9H5ClN2O2/c10-7-3-6-5-11-2-1-8(6)9(4-7)12(13)14/h1-5H

InChI key: InChIKey=CFIWPCCLFBNWCW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C2=C(C=C(Cl)C1)C=NC=C2

Synonyms:

• Isoquinoline, 7-chloro-5-nitro-
• 7-Chloro-5-nitroisoquinoline