CAS 1335051-91-6
:3,4-Dibromo-5-chloropyridine
Description:
3,4-Dibromo-5-chloropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and one chlorine atom. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and solubility. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The bromine and chlorine atoms can participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions, making it a valuable building block in organic synthesis. Additionally, the compound's halogenated nature may impart specific biological activities, which can be explored in medicinal chemistry. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks and environmental concerns.
Formula:C5H2Br2ClN
InChI:InChI=1S/C5H2Br2ClN/c6-3-1-9-2-4(8)5(3)7/h1-2H
SMILES:c1c(c(c(cn1)Cl)Br)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
