CAS 1335051-94-9
:3-Bromo-5-chloro-N-methyl-4-pyridinamine
Description:
3-Bromo-5-chloro-N-methyl-4-pyridinamine is an organic compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with both bromine and chlorine atoms, as well as a methylamino group. The presence of these halogen substituents typically imparts unique reactivity and solubility properties, making it of interest in various chemical applications, including medicinal chemistry and agrochemicals. The compound's molecular structure suggests potential for hydrogen bonding due to the amino group, which can influence its interactions in biological systems. Additionally, the halogen atoms can enhance lipophilicity, potentially affecting the compound's bioavailability and pharmacokinetics. As a pyridinamine derivative, it may exhibit biological activity, which could be explored in drug development or as a biochemical probe. Safety and handling considerations are important, as halogenated compounds can pose environmental and health risks. Overall, 3-Bromo-5-chloro-N-methyl-4-pyridinamine represents a versatile chemical entity with potential applications in various fields of chemistry and biology.
Formula:C6H6BrClN2
InChI:InChI=1S/C6H6BrClN2/c1-9-6-4(7)2-10-3-5(6)8/h2-3H,1H3,(H,9,10)
InChI key:InChIKey=JWDSESBDXQDPQD-UHFFFAOYSA-N
SMILES:N(C)C=1C(Br)=CN=CC1Cl
Synonyms:- 3-Bromo-5-chloro-N-methyl-4-pyridinamine
- 4-Pyridinamine, 3-bromo-5-chloro-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
