
CAS 1335051-98-3
:5-Bromo-2-chloro-3-(2-oxiranyl)pyridine
Description:
5-Bromo-2-chloro-3-(2-oxiranyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 5-position with a bromine atom and at the 2-position with a chlorine atom. Additionally, it features an epoxide group (2-oxiranyl) at the 3-position of the pyridine ring. This compound exhibits properties typical of halogenated pyridines, such as potential reactivity in nucleophilic substitution reactions due to the presence of the electrophilic halogen atoms. The epoxide group contributes to its chemical reactivity, making it a useful intermediate in organic synthesis. The presence of multiple functional groups suggests that it may exhibit diverse biological activities, which could be of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and dipole-dipole interactions, influencing its solubility and stability in different solvents. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C7H5BrClNO
InChI:InChI=1S/C7H5BrClNO/c8-4-1-5(6-3-11-6)7(9)10-2-4/h1-2,6H,3H2
InChI key:InChIKey=OIYLUUFYPNOAJT-UHFFFAOYSA-N
SMILES:ClC1=C(C=C(Br)C=N1)C2CO2
Synonyms:- 5-Bromo-2-chloro-3-(2-oxiranyl)pyridine
- Pyridine, 5-bromo-2-chloro-3-(2-oxiranyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.