
CAS 1335056-01-3
:4,5-Dimethyl-3-pyridinamine
Description:
4,5-Dimethyl-3-pyridinamine, with the CAS number 1335056-01-3, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two methyl groups attached to the 4 and 5 positions of the pyridine ring and an amino group (-NH2) at the 3 position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is likely to exhibit basic properties due to the amino group, which can participate in hydrogen bonding and influence solubility in polar solvents. Additionally, the methyl groups can affect the steric hindrance and electronic properties of the molecule, potentially impacting its biological activity. As with many nitrogen-containing heterocycles, 4,5-Dimethyl-3-pyridinamine may also exhibit interesting interactions with biological targets, making it a subject of interest for further research in medicinal chemistry.
Formula:C7H10N2
InChI:InChI=1S/C7H10N2/c1-5-3-9-4-7(8)6(5)2/h3-4H,8H2,1-2H3
InChI key:InChIKey=YFBUVAGRKDHZCU-UHFFFAOYSA-N
SMILES:CC=1C(C)=CN=CC1N
Synonyms:- 3-Amino-4,5-dimethylpyridine
- 3-Pyridinamine, 4,5-dimethyl-
- 4,5-Dimethyl-3-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.