CAS 1335056-43-3

5-Bromo-3-chloro-α-methyl-2-pyridinemethanol

Description:

5-Bromo-3-chloro-α-methyl-2-pyridinemethanol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of bromine and chlorine substituents on the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The α-methyl group indicates that there is a methyl group attached to the carbon adjacent to the nitrogen in the pyridine structure, which can influence the compound's steric and electronic properties. The hydroxymethyl group (-CH2OH) at the 2-position enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions and applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its unique combination of halogen and hydroxyl functionalities can also facilitate further derivatization, allowing for the exploration of its potential as a precursor in the synthesis of more complex molecules. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.

Formula: C₇H₇BrClNO

InChI: InChI=1S/C7H7BrClNO/c1-4(11)7-6(9)2-5(8)3-10-7/h2-4,11H,1H3

InChI key: InChIKey=RXFANSAWPGZCEY-UHFFFAOYSA-N

SMILES: C(C)(O)C1=C(Cl)C=C(Br)C=N1

Synonyms:

• 2-Pyridinemethanol, 5-bromo-3-chloro-α-methyl-
• 5-Bromo-3-chloro-α-methyl-2-pyridinemethanol