CAS 13351-61-6
:2,2-Dimethyl-3-phenylpropanol
Description:
2,2-Dimethyl-3-phenylpropanol, with the CAS number 13351-61-6, is an organic compound characterized by its structure, which features a tertiary alcohol group. This compound consists of a propanol backbone with two methyl groups attached to the second carbon and a phenyl group attached to the third carbon. It is typically a colorless to pale yellow liquid at room temperature and exhibits a relatively low volatility. The presence of the hydroxyl (-OH) group imparts polar characteristics, making it soluble in polar solvents like alcohols and ethers, while its hydrophobic phenyl and methyl groups contribute to its overall hydrophobicity. This compound can participate in various chemical reactions, including oxidation and esterification, and is of interest in organic synthesis and medicinal chemistry. Its unique structure may also influence its physical properties, such as boiling point and melting point, as well as its reactivity in different chemical environments. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H16O
InChI:InChI=1S/C11H16O/c1-11(2,9-12)8-10-6-4-3-5-7-10/h3-7,12H,8-9H2,1-2H3
InChI key:InChIKey=VNGAHMPMLRTSLF-UHFFFAOYSA-N
SMILES:C(C(CO)(C)C)C1=CC=CC=C1
Synonyms:- 1-Propanol, 2,2-dimethyl-3-phenyl-
- 2,2-Dimethyl-3-Phenyl-1-Propanol
- 2,2-Dimethyl-3-Phenylpropan-1-Ol
- 2,2-Dimethyl-3-phenylpropyl alcohol
- Benzenepropanol, β,β-dimethyl-
- Muguet alcohol
- β,β-Dimethylbenzenepropanol
- 2,2-Dimethyl-3-phenylpropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.