CymitQuimica logo

CAS 1335112-98-5

:

4-[[(4-Chloro-2-fluorophenyl)amino]methyl]-4-piperidinol

Description:
4-[[(4-Chloro-2-fluorophenyl)amino]methyl]-4-piperidinol, identified by its CAS number 1335112-98-5, is a chemical compound characterized by its piperidine structure, which includes a piperidinol moiety. This compound features a 4-chloro-2-fluorophenyl group attached to an amino methyl group, contributing to its potential biological activity. The presence of halogen substituents, such as chlorine and fluorine, often influences the compound's lipophilicity and reactivity, which can affect its pharmacological properties. The piperidinol structure may impart certain stability and solubility characteristics, making it of interest in medicinal chemistry. This compound may be investigated for its potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting various biological pathways. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in different environments and applications. Safety and handling considerations are also crucial, given the presence of halogenated groups, which can pose specific health and environmental risks.
Formula:C12H16ClFN2O
InChI:InChI=1S/C12H16ClFN2O/c13-9-1-2-11(10(14)7-9)16-8-12(17)3-5-15-6-4-12/h1-2,7,15-17H,3-6,8H2
InChI key:InChIKey=JJBLRCNVYLCYHR-UHFFFAOYSA-N
SMILES:N(CC1(O)CCNCC1)C2=C(F)C=C(Cl)C=C2
Synonyms:
  • 4-Piperidinol, 4-[[(4-chloro-2-fluorophenyl)amino]methyl]-
  • 4-[[(4-Chloro-2-fluorophenyl)amino]methyl]-4-piperidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.