CAS 1335113-01-3
:1-(5-Bromo-6-methoxy-2-methyl-3-pyridinyl)ethanone
Description:
1-(5-Bromo-6-methoxy-2-methyl-3-pyridinyl)ethanone is a chemical compound characterized by its pyridine ring, which is substituted with a bromine atom, a methoxy group, and a methyl group. This compound features an ethanone functional group, indicating the presence of a carbonyl (C=O) adjacent to an ethyl group. The bromine substitution typically enhances the compound's reactivity and can influence its biological activity, while the methoxy group may contribute to its solubility and electronic properties. The presence of the methyl group on the pyridine ring can affect steric hindrance and the overall molecular conformation. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, as many pyridine derivatives exhibit biological activity. Its specific applications and interactions would depend on further studies, including its synthesis, stability, and reactivity under various conditions. As with any chemical substance, safety data and handling precautions should be observed when working with this compound.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c1-5-7(6(2)12)4-8(10)9(11-5)13-3/h4H,1-3H3
InChI key:InChIKey=ISOWAXNWRAJQDT-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(C)N=C(OC)C(Br)=C1
Synonyms:- 1-(5-Bromo-6-methoxy-2-methyl-3-pyridinyl)ethanone
- Ethanone, 1-(5-bromo-6-methoxy-2-methyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(5-Bromo-6-methoxy-2-methylpyridin-3-yl)ethan-1-one
CAS:1-(5-Bromo-6-methoxy-2-methylpyridin-3-yl)ethan-1-one
Molecular weight:244.09g/mol
