CAS 1335113-07-9
:1,4-Dibromo-3-methoxy-2-naphthalenol
Description:
1,4-Dibromo-3-methoxy-2-naphthalenol is an organic compound characterized by its naphthalene backbone, which is substituted at specific positions with bromine and methoxy groups, as well as a hydroxyl group. This compound features two bromine atoms located at the 1 and 4 positions of the naphthalene ring, contributing to its reactivity and potential applications in various chemical reactions. The methoxy group at the 3 position enhances its solubility in organic solvents and may influence its electronic properties. The presence of the hydroxyl group at the 2 position introduces polarity, making the compound more hydrophilic compared to other naphthalene derivatives. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its unique structure allows for potential applications in materials science, pharmaceuticals, and as a reagent in organic synthesis. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with brominated organic compounds.
Formula:C11H8Br2O2
InChI:InChI=1S/C11H8Br2O2/c1-15-11-9(13)7-5-3-2-4-6(7)8(12)10(11)14/h2-5,14H,1H3
InChI key:InChIKey=JSEYBJXZSRIZSK-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(Br)=C(O)C1OC)C=CC=C2
Synonyms:- 1,4-Dibromo-3-methoxy-2-naphthalenol
- 2-Naphthalenol, 1,4-dibromo-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4-Dibromo-3-methoxynaphthalen-2-ol
CAS:<p>1,4-Dibromo-3-methoxynaphthalen-2-ol</p>Molecular weight:331.99g/mol
