CAS 133512-64-8

1-[4-(1,1,2,2,2-Pentafluoroethyl)phenyl]ethanone

Description:

1-[4-(1,1,2,2,2-Pentafluoroethyl)phenyl]ethanone, with the CAS number 133512-64-8, is an organic compound characterized by its unique structure that includes a phenyl ring substituted with a pentafluoroethyl group and an ethanone functional group. This compound is notable for its fluorinated moiety, which imparts distinct physical and chemical properties, such as increased lipophilicity and thermal stability. The presence of multiple fluorine atoms enhances its reactivity and can influence its interaction with biological systems, making it of interest in various fields, including pharmaceuticals and materials science. The compound typically exhibits a relatively low volatility due to the strong C-F bonds, contributing to its stability under various conditions. Additionally, its synthesis often involves the use of specialized reagents and conditions to ensure the integrity of the fluorinated groups. Overall, 1-[4-(1,1,2,2,2-Pentafluoroethyl)phenyl]ethanone represents a class of fluorinated organic compounds that are valuable for their unique properties and potential applications.

Formula: C₁₀H₇F₅O

InChI: InChI=1S/C10H7F5O/c1-6(16)7-2-4-8(5-3-7)9(11,12)10(13,14)15/h2-5H,1H3

InChI key: InChIKey=MJKWGQSNHHRITB-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(F)(F)C1=CC=C(C(C)=O)C=C1

Synonyms:

• 1-[4-(1,1,2,2,2-Pentafluoroethyl)phenyl]ethanone
• 1-(4-(Perfluoroethyl)-phenyl)ethan-1-one
• Ethanone, 1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-
• Ethanone, 1-[4-(pentafluoroethyl)phenyl]-
• 1-(4-(Pentafluoroethyl)phenyl)ethanone

4’-(Pentafluoroethyl)acetophenone

CAS: 133512-64-8

4’-(Pentafluoroethyl)acetophenone

Purity: ≥95%

Molecular weight: 238.15g/mol

Ref: 54-PC50120