CAS 13352-78-8
:2,4,6,8,10,12,14,16,18-Nonaoxanonadecane
Description:
2,4,6,8,10,12,14,16,18-Nonaoxanonadecane, with the CAS number 13352-78-8, is a synthetic chemical compound belonging to the class of polyethers. It is characterized by a long carbon chain consisting of 19 carbon atoms, interspersed with nine ether linkages (-O-). This structure imparts unique properties, such as increased flexibility and lower melting points compared to similar hydrocarbons. The presence of multiple ether groups enhances its solubility in polar solvents and contributes to its potential applications in various fields, including surfactants, lubricants, and as a component in polymer formulations. The compound is typically colorless and may exhibit low volatility. Its stability under a range of temperatures makes it suitable for industrial applications. However, like many synthetic compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, 2,4,6,8,10,12,14,16,18-Nonaoxanonadecane is notable for its unique structural characteristics and potential utility in chemical applications.
Formula:C10H22O9
InChI:InChI=1S/C10H22O9/c1-11-3-13-5-15-7-17-9-19-10-18-8-16-6-14-4-12-2/h3-10H2,1-2H3
InChI key:InChIKey=KGCHCZLEIBUSBO-UHFFFAOYSA-N
SMILES:O(COCOCOCOC)COCOCOCOC
Synonyms:- Octaoxymethylene dimethyl ether
- Ether, bis[[[(methoxymethoxy)methoxy]methoxy]methyl]
- 2,4,6,8,10,12,14,16,18-Nonaoxanonadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
