CAS 1335210-26-8

Methyl 2-[[(2,2-dimethoxyethyl)amino]methylene]-4-methoxy-3-oxobutanoate

Description:

Methyl 2-[[(2,2-dimethoxyethyl)amino]methylene]-4-methoxy-3-oxobutanoate, with the CAS number 1335210-26-8, is a chemical compound characterized by its complex structure, which includes a methoxy group and an oxobutanoate moiety. This compound features a methylene bridge connecting an amino group to a carbonyl group, contributing to its potential reactivity and biological activity. The presence of dimethoxyethyl groups suggests that it may exhibit solubility in organic solvents, while the methoxy groups can influence its electronic properties and steric hindrance. Such characteristics may render it useful in various applications, including medicinal chemistry and organic synthesis. The compound's unique structure may also suggest potential interactions with biological targets, making it of interest for research in pharmacology. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with any chemical substance, safety data and handling precautions should be consulted before use.

Formula: C₁₁H₁₉NO₆

InChI: InChI=1S/C11H19NO6/c1-15-7-9(13)8(11(14)18-4)5-12-6-10(16-2)17-3/h5,10,12H,6-7H2,1-4H3

InChI key: InChIKey=UFIPOMSTPOSCBR-UHFFFAOYSA-N

SMILES: C(=CNCC(OC)OC)(C(COC)=O)C(OC)=O

Synonyms:

• Butanoic acid, 2-[[(2,2-dimethoxyethyl)amino]methylene]-4-methoxy-3-oxo-, methyl ester
• Methyl 2-[[(2,2-dimethoxyethyl)amino]methylene]-4-methoxy-3-oxobutanoate

Methyl (E)-2-(((2,2-dimethoxyethyl)amino)methylene)-4-methoxy-3-oxobutanoate

CAS: 1335210-26-8

Purity: 95%

Molecular weight: 261.2739868

Ref: 10-F609214