CAS 1335220-59-1
:6-Chloro-2-(1-piperidinyl)-1,8-naphthyridine-3-carbonitrile
Description:
6-Chloro-2-(1-piperidinyl)-1,8-naphthyridine-3-carbonitrile is a chemical compound characterized by its complex structure, which includes a naphthyridine core substituted with a chlorine atom and a piperidine group. This compound features a carbonitrile functional group, contributing to its potential reactivity and biological activity. The presence of the piperidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The chlorine atom enhances lipophilicity and may influence the compound's pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential as pharmaceuticals, particularly in the context of treating various diseases, including cancer and neurological disorders. Its specific properties, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C14H13ClN4
InChI:InChI=1S/C14H13ClN4/c15-12-7-10-6-11(8-16)14(18-13(10)17-9-12)19-4-2-1-3-5-19/h6-7,9H,1-5H2
InChI key:InChIKey=XAXJTISLOQAGJI-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=NC2=C(C1)C=C(Cl)C=N2)N3CCCCC3
Synonyms:- 6-Chloro-2-(1-piperidinyl)-1,8-naphthyridine-3-carbonitrile
- 1,8-Naphthyridine-3-carbonitrile, 6-chloro-2-(1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Chloro-2-(piperidin-1-yl)-1,8-naphthyridine-3-carbonitrile
CAS:<p>6-Chloro-2-(piperidin-1-yl)-1,8-naphthyridine-3-carbonitrile</p>Molecular weight:272.73g/mol
