CAS 1335234-29-1

B-[3-Methyl-4-[(tetrahydro-3-furanyl)oxy]phenyl]boronic acid

Description:

B-[3-Methyl-4-[(tetrahydro-3-furanyl)oxy]phenyl]boronic acid, identified by its CAS number 1335234-29-1, is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a methyl group and a tetrahydro-3-furanyl ether, contributing to its unique chemical properties. The boronic acid moiety allows for potential applications in organic synthesis, particularly in Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds. Additionally, the presence of the tetrahydrofuran ring may enhance solubility and reactivity in various solvents. The compound's structure suggests it may exhibit interesting biological activity, making it a candidate for further research in medicinal chemistry. Overall, its distinctive functional groups and structural features position it as a valuable compound in both synthetic and pharmaceutical chemistry.

Formula: C₁₁H₁₅BO₄

InChI: InChI=1S/C11H15BO4/c1-8-6-9(12(13)14)2-3-11(8)16-10-4-5-15-7-10/h2-3,6,10,13-14H,4-5,7H2,1H3

InChI key: InChIKey=AHQYPSCKYUMCSC-UHFFFAOYSA-N

SMILES: O(C1=C(C)C=C(B(O)O)C=C1)C2CCOC2

Synonyms:

• B-[3-Methyl-4-[(tetrahydro-3-furanyl)oxy]phenyl]boronic acid
• Boronic acid, B-[3-methyl-4-[(tetrahydro-3-furanyl)oxy]phenyl]-