CAS 1335234-33-7

B-[4-[(Tetrahydro-3-furanyl)oxy]phenyl]boronic acid

Description:

B-[4-[(Tetrahydro-3-furanyl)oxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a tetrahydro-3-furanyl ether, contributing to its unique reactivity and solubility properties. Boronic acids are typically polar and can participate in hydrogen bonding, which influences their solubility in different solvents. This specific compound may exhibit properties such as moderate stability under ambient conditions, and its reactivity can be modulated by the presence of the furan ring, which can participate in further chemical transformations. Additionally, boronic acids are often utilized in cross-coupling reactions, making them valuable in the synthesis of complex organic molecules. Overall, B-[4-[(Tetrahydro-3-furanyl)oxy]phenyl]boronic acid is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₀H₁₃BO₄

InChI: InChI=1S/C10H13BO4/c12-11(13)8-1-3-9(4-2-8)15-10-5-6-14-7-10/h1-4,10,12-13H,5-7H2

InChI key: InChIKey=UFIRHIKFYGAQSK-UHFFFAOYSA-N

SMILES: O(C1=CC=C(B(O)O)C=C1)C2CCOC2

Synonyms:

• Boronic acid, B-[4-[(tetrahydro-3-furanyl)oxy]phenyl]-
• [4-(Oxolan-3-yloxy)phenyl]boronic acid
• B-[4-[(Tetrahydro-3-furanyl)oxy]phenyl]boronic acid

[4-(oxolan-3-yloxy)phenyl]boronic acid

CAS: 1335234-33-7

Formula: C₁₀H₁₃BO₄

Molecular weight: 208.0188

Ref: IN-DA01AJ3E

[4-(Oxolan-3-yloxy)phenyl]boronic acid

CAS: 1335234-33-7

Versatile small molecule scaffold

Formula: C₁₀H₁₃BO₄

Purity: Min. 95%

Molecular weight: 208.02 g/mol

Ref: 3D-KDC23433