CAS 1335234-35-9

3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

Description:

3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is substituted at the 3 and 5 positions with trifluoromethyl groups. This substitution imparts significant lipophilicity and electron-withdrawing properties, enhancing the compound's reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of a carboxylic acid functional group at the 4 position contributes to its acidity and solubility in polar solvents. The trifluoromethyl groups also influence the compound's biological activity, making it a subject of interest in medicinal chemistry for developing new therapeutic agents. Additionally, the compound's unique structure may exhibit interesting properties such as enhanced stability and selectivity in chemical reactions. Overall, 3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is notable for its distinctive electronic characteristics and potential utility in various chemical applications.

Formula: C₆H₂F₆N₂O₂

InChI: InChI=1S/C6H2F6N2O2/c7-5(8,9)2-1(4(15)16)3(14-13-2)6(10,11)12/h(H,13,14)(H,15,16)

InChI key: InChIKey=FWWATELKMKWQKZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(C(F)(F)F)=NNC1C(F)(F)F

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 3,5-bis(trifluoromethyl)-
• 3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

CAS: 1335234-35-9

3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

Purity: 95%

Molecular weight: 248.08g/mol

Ref: 54-PC1002931

3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

CAS: 1335234-35-9

3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a chiral compound that has been shown to be an active building block for coordination frameworks. It is prepared from the reaction of 3,5-bis(trifluoromethyl)-1H-pyrazole with a carboxylic acid and can be used in the synthesis of metalloporphyrins. 3,5-Bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid has been shown to form stable coordination complexes with ligands such as bidentate or tridentate phosphoramidites and dimethylammonium chloride. This compound undergoes thermal treatment during the preparation process and reacts with various solvents and reagents.

Formula: C₆H₂F₆N₂O₂

Purity: Min. 95%

Molecular weight: 248.08 g/mol

Ref: 3D-KDC23435