CAS 13353-04-3
:2,4,6,8,10,12,14,16-Octaoxaheptadecane
Description:
2,4,6,8,10,12,14,16-Octaoxaheptadecane, with the CAS number 13353-04-3, is a synthetic organic compound characterized by its long carbon chain and multiple ether linkages. This molecule consists of a heptadecane backbone, which is a 17-carbon alkane, with eight ether (-O-) groups integrated into its structure. The presence of these ether linkages contributes to its unique properties, such as increased solubility in polar solvents and potential applications in various fields, including materials science and pharmaceuticals. The compound is typically colorless and may exhibit low volatility due to its high molecular weight. Its structure suggests that it could have interesting thermal and chemical stability, making it suitable for use in specialized applications. Additionally, the presence of multiple oxygen atoms may impart hydrophilic characteristics, influencing its interaction with water and other solvents. Overall, 2,4,6,8,10,12,14,16-Octaoxaheptadecane is notable for its complex structure and potential utility in various chemical applications.
Formula:C9H20O8
InChI:InChI=1S/C9H20O8/c1-10-3-12-5-14-7-16-9-17-8-15-6-13-4-11-2/h3-9H2,1-2H3
InChI key:InChIKey=PCGQGRSPGOZXTL-UHFFFAOYSA-N
SMILES:C(OCOCOCOC)OCOCOCOC
Synonyms:- Methane, bis[[(methoxymethoxy)methoxy]methoxy]-
- 2,4,6,8,10,12,14,16-Octaoxaheptadecane
- Hepta(oxymethylene) dimethyl ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
