CymitQuimica logo

CAS 133541-45-4

:

4-bromo-2,5-difluorobenzonitrile

Description:
4-Bromo-2,5-difluorobenzonitrile is an aromatic compound characterized by the presence of a bromine atom, two fluorine atoms, and a nitrile group attached to a benzene ring. Its molecular structure features a benzene core with the bromine substituent located at the para position relative to the nitrile group, while the fluorine atoms are positioned at the ortho and meta positions. This compound is typically a solid at room temperature and exhibits properties common to halogenated aromatic compounds, such as increased reactivity and potential for participation in electrophilic substitution reactions. The presence of the nitrile group contributes to its polarity and can influence its solubility in various solvents. Additionally, 4-bromo-2,5-difluorobenzonitrile may exhibit interesting electronic properties due to the electron-withdrawing effects of the bromine and fluorine substituents, making it a candidate for applications in organic synthesis and materials science. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.
Formula:C7H2BrF2N
InChI:InChI=1S/C7H2BrF2N/c8-5-2-6(9)4(3-11)1-7(5)10/h1-2H
InChI key:YIEQHIRFLYNDKP-UHFFFAOYSA-N
SMILES:c1c(C#N)c(cc(c1F)Br)F
Synonyms:
  • Benzonitrile, 4-bromo-2,5-difluoro-
Found 4 products.