CAS 133550-34-2
:TYRPHOSTIN B46
Description:
Tyrphostin B46, with the CAS number 133550-34-2, is a synthetic compound known for its role as a selective inhibitor of receptor tyrosine kinases, particularly in the context of cancer research. It is part of a broader class of tyrphostins, which are characterized by their ability to interfere with the signaling pathways that promote cell proliferation and survival. This compound exhibits properties that make it valuable in studying cellular processes and potential therapeutic applications. Tyrphostin B46 is typically used in laboratory settings to investigate its effects on various cellular mechanisms, including apoptosis and cell cycle regulation. Its chemical structure features specific functional groups that contribute to its inhibitory activity, making it a useful tool in pharmacological studies. Additionally, research has indicated that it may have implications in the development of targeted cancer therapies, as it can modulate the activity of specific kinases involved in tumor growth and metastasis. However, detailed safety and handling information should be consulted before use in any experimental protocols.
Formula:C19H18N2O3
InChI:InChI=1/C19H18N2O3/c20-13-16(11-15-8-9-17(22)18(23)12-15)19(24)21-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12,22-23H,4,7,10H2,(H,21,24)/b16-11+
Synonyms:- (E)-2-Cyano-3-(3,4-Dihydroxyphenyl)-N-(3-Phenylpropyl)-2-Propenamide
- Ag 555
- Alpha-Cyano-(3,4-Dihydroxy)-N-(3-Phenylpropyl)Cinnamide
- N-(3-Phenylpropyl)-3,4-Dihydroxy-Alpha Cyanocinnamide
- N-(3'-Phenylpropyl)-3,4-Dihydroxybenzylidenecyanoacetamide
- Tyrphostin Ag 555
- Tyrphostin B46, N-(3μ-Phenylpropyl)-3,4-dihydroxybenzylidenecyanoacetamide
- (2E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(3-phenylpropyl)prop-2-enamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tyrphostin B46, 98+%
CAS:<p>Inhibitor of EGF receptor kinase activity</p>Formula:C19H18N2O3Purity:98+%Molecular weight:322.36AG 555
CAS:<p>AG 555 (Tyrphostin B46) is an EGFR tyrosine kinase inhibitor.</p>Formula:C19H18N2O3Purity:98.02% - 99.94%Color and Shape:SolidMolecular weight:322.36AG 555
CAS:AG 555 is a taxane that is used to treat bowel disease, including colorectal cancer. It has been shown to inhibit protein target and water permeability in diabetic neuropathy. AG 555 has also been shown to suppress inflammatory bowel disease by inhibiting the activation of epidermal growth factor signaling pathways and BCR-ABL kinase. This drug also has anticancer activity against human pluripotent cells, which may be due to its ability to inhibit viral life.Formula:C19H18N2O3Purity:Min. 95%Molecular weight:322.36 g/mol




