CAS 133551-98-1
:naphthofluorescein di-(B-D-*galactopyranoside)
Description:
Naphthofluorescein di-(B-D-galactopyranoside) is a synthetic chemical compound that serves as a fluorescent probe, commonly used in biochemical and cellular studies. This compound features a naphthofluorescein moiety, which is known for its strong fluorescent properties, making it useful in various applications such as microscopy and flow cytometry. The di-(B-D-galactopyranoside) component indicates that it has two galactopyranoside sugar units, which can enhance its solubility in aqueous environments and facilitate cellular uptake. This structure allows for specific interactions with enzymes, particularly glycosidases, which can cleave the sugar moieties, leading to the release of the fluorescent naphthofluorescein. As a result, it is often employed in studies involving enzyme activity, cellular localization, and tracking biological processes. The compound's stability, solubility, and fluorescence characteristics make it a valuable tool in molecular biology and biochemistry research.
Formula:C40H36O15
InChI:InChI=1/C40H36O15/c41-15-27-29(43)31(45)33(47)38(52-27)50-19-7-9-21-17(13-19)5-11-25-35(21)54-36-22-10-8-20(51-39-34(48)32(46)30(44)28(16-42)53-39)14-18(22)6-12-26(36)40(25)24-4-2-1-3-23(24)37(49)55-40/h1-14,27-34,38-39,41-48H,15-16H2
SMILES:c1ccc2c(c1)C(=O)OC12c2ccc3cc(ccc3c2Oc2c3ccc(cc3ccc12)OC1C(C(C(C(CO)O1)O)O)O)OC1C(C(C(C(CO)O1)O)O)O
Synonyms:- 11'-(hexopyranosyloxy)-3-oxo-3H-spiro[2-benzofuran-1,7'-dibenzo[c,h]xanthen]-3'-yl hexopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Naphthofluorescein di-O-(b-D-galactopyranoside)
CAS:<p>Naphthofluorescein di-O-(b-D-galactopyranoside) is a fluorescent dye that is used in the study of polysaccharides, saccharides, and carbohydrates. This dye is a methylated derivative of naphthofluorescein with an additional sugar molecule attached to the fluorescing part. The chemical formula for this compound is C12H14N2O7 b-D-Galactopyranoside. The molecular weight of this compound is 542.3 g/mol. Naphthofluorescein di-O-(b-D-galactopyranoside) has CAS No. 133551-98-1 and can be found on the website of Chemical Abstracts Service (CAS).</p>Formula:C40H36O15Purity:Min. 95%Molecular weight:756.7 g/mol

