CAS 133559-43-0
:3-TRIFLUOROMETHANESULFONYLOXY-BUT-2-ENOIC ACID METHYL ESTER
Description:
3-Trifluoromethanesulfonyloxy-but-2-enoic acid methyl ester, with the CAS number 133559-43-0, is a chemical compound characterized by its unique functional groups and structure. It features a but-2-enoic acid backbone, which is an unsaturated carboxylic acid, modified by the presence of a trifluoromethanesulfonyl group. This trifluoromethanesulfonyl moiety imparts significant reactivity and polarity to the compound, making it useful in various chemical reactions, particularly in organic synthesis and as a reagent in fluorination processes. The methyl ester functionality enhances its solubility in organic solvents, facilitating its application in laboratory settings. Additionally, the presence of fluorine atoms contributes to the compound's stability and potential bioactivity. Overall, this compound is of interest in both academic research and industrial applications, particularly in the development of pharmaceuticals and agrochemicals, due to its unique chemical properties and reactivity profile.
Formula:C6H7F3O5S
InChI:InChI=1/C6H7F3O5S/c1-4(3-5(10)13-2)14-15(11,12)6(7,8)9/h3H,1-2H3/b4-3-
SMILES:C/C(=C/C(=O)OC)/OS(=O)(=O)C(F)(F)F
Synonyms:- Methyl 3-(Trifluoromethylsulfonyloxy) Crotonate
- (S)-12-T-Butyl-Beta-Alanine
- methyl (2Z)-3-{[(trifluoromethyl)sulfonyl]oxy}but-2-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Trifluoromethanesulfonyloxy-but-2-enoic acid methyl ester
CAS:Formula:C6H7F3O5SMolecular weight:248.1770
