CymitQuimica logo

CAS 133560-58-4

:

4-Bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrazole

Description:
4-Bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a bromine atom and an ethoxy group that is further modified by a trimethylsilyl group. This compound typically exhibits properties associated with both the pyrazole moiety and the presence of the bromine and silyl substituents, such as potential reactivity in nucleophilic substitution reactions and stability under various conditions. The trimethylsilyl group enhances the compound's lipophilicity, which can influence its solubility and interaction with biological systems. Additionally, the presence of the bromine atom may impart specific electronic properties, making it useful in various synthetic applications, including medicinal chemistry and material science. Overall, this compound's characteristics make it a subject of interest for research in organic synthesis and potential pharmaceutical applications.
Formula:C9H17BrN2OSi
InChI:InChI=1S/C9H17BrN2OSi/c1-14(2,3)5-4-13-8-12-7-9(10)6-11-12/h6-7H,4-5,8H2,1-3H3
InChI key:InChIKey=DIEAIDCZEZGMJP-UHFFFAOYSA-N
SMILES:C(OCC[Si](C)(C)C)N1C=C(Br)C=N1
Synonyms:
  • 1H-Pyrazole, 4-bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-
  • [2-[(4-Bromopyrazol-1-yl)methoxy]ethyl]trimethylsilane
  • 4-Bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.