CymitQuimica logo

CAS 133562-23-9

:

α-(Aminomethyl)-α-methyl-1-naphthalenemethanol

Description:
α-(Aminomethyl)-α-methyl-1-naphthalenemethanol, with the CAS number 133562-23-9, is a chemical compound characterized by its complex structure, which includes a naphthalene ring system substituted with an aminomethyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The aminomethyl group can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, while the hydroxymethyl group may engage in hydrogen bonding, influencing its physical properties and interactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific applications and behavior in various environments would depend on factors such as pH, temperature, and the presence of other chemical species. Overall, α-(Aminomethyl)-α-methyl-1-naphthalenemethanol represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C13H15NO
InChI:InChI=1S/C13H15NO/c1-13(15,9-14)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,15H,9,14H2,1H3
InChI key:InChIKey=ZTICQVCWSGAEFA-UHFFFAOYSA-N
SMILES:C(CN)(C)(O)C=1C2=C(C=CC=C2)C=CC1
Synonyms:
  • α-(Aminomethyl)-α-methyl-1-naphthalenemethanol
  • 1-Naphthalenemethanol, α-(aminomethyl)-α-methyl-
  • 1-Amino-2-(naphthalen-1-yl)propan-2-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.