
CAS 133562-27-3
:α-(Aminomethyl)-3-bromo-α-methylbenzenemethanol
Description:
α-(Aminomethyl)-3-bromo-α-methylbenzenemethanol, identified by its CAS number 133562-27-3, is a chemical compound that features a complex structure characterized by the presence of an amino group, a bromine atom, and a hydroxymethyl group attached to a methyl-substituted aromatic ring. This compound is typically categorized as an aromatic alcohol due to the presence of the hydroxymethyl functional group. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The bromine substituent may impart unique reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. Additionally, the amino group can participate in hydrogen bonding, influencing the compound's solubility and reactivity. Overall, the characteristics of this compound, including its functional groups and substituents, contribute to its potential utility in various chemical applications. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C9H12BrNO
InChI:InChI=1S/C9H12BrNO/c1-9(12,6-11)7-3-2-4-8(10)5-7/h2-5,12H,6,11H2,1H3
InChI key:InChIKey=HZTWHHWNUJWXGR-UHFFFAOYSA-N
SMILES:C(CN)(C)(O)C1=CC(Br)=CC=C1
Synonyms:- α-(Aminomethyl)-3-bromo-α-methylbenzenemethanol
- 1-Amino-2-(3-bromophenyl)propan-2-ol
- Benzenemethanol, α-(aminomethyl)-3-bromo-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.