CAS 133562-29-5
:α-(Aminomethyl)-2-fluoro-α-methylbenzenemethanol
Description:
α-(Aminomethyl)-2-fluoro-α-methylbenzenemethanol, with the CAS number 133562-29-5, is a chemical compound characterized by its unique functional groups and structural features. It contains an amino group (-NH2), a fluorine atom, and a hydroxyl group (-OH) attached to a benzene ring, which contributes to its reactivity and potential biological activity. The presence of the fluorine atom often enhances the lipophilicity and metabolic stability of the compound, making it of interest in medicinal chemistry. The compound's structure suggests it may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, the amino and hydroxyl groups can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of drug development and chemical synthesis.
Formula:C9H12FNO
InChI:InChI=1S/C9H12FNO/c1-9(12,6-11)7-4-2-3-5-8(7)10/h2-5,12H,6,11H2,1H3
InChI key:InChIKey=CIMQZVBLCOCGBW-UHFFFAOYSA-N
SMILES:C(CN)(C)(O)C1=C(F)C=CC=C1
Synonyms:- 1-Amino-2-(2-fluorophenyl)propan-2-ol
- Benzenemethanol, α-(aminomethyl)-2-fluoro-α-methyl-
- α-(Aminomethyl)-2-fluoro-α-methylbenzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.