
CAS 133562-37-5
:α-(Aminomethyl)-2,4-dimethylbenzenemethanol
Description:
α-(Aminomethyl)-2,4-dimethylbenzenemethanol, with the CAS number 133562-37-5, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methyl groups and a hydroxymethyl group. The presence of an amino group (-NH2) attached to the carbon chain enhances its reactivity and solubility in polar solvents. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to form hydrogen bonds, which can influence its boiling point and solubility. It may also participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound's structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-7-3-4-9(8(2)5-7)10(12)6-11/h3-5,10,12H,6,11H2,1-2H3
InChI key:InChIKey=KBYFBXUWYPZHTQ-UHFFFAOYSA-N
SMILES:C(CN)(O)C1=C(C)C=C(C)C=C1
Synonyms:- α-(Aminomethyl)-2,4-dimethylbenzenemethanol
- 2-Amino-1-(2,4-dimethylphenyl)ethan-1-ol
- Benzenemethanol, α-(aminomethyl)-2,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.