
CAS 133562-38-6
:α-(Aminomethyl)-2,5-dimethylbenzenemethanol
Description:
α-(Aminomethyl)-2,5-dimethylbenzenemethanol, identified by its CAS number 133562-38-6, is an organic compound characterized by the presence of an amino group and a hydroxymethyl group attached to a dimethyl-substituted benzene ring. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. Its structure suggests that it may have applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the amino group can impart basicity, while the hydroxymethyl group can enhance reactivity in various chemical reactions. Additionally, the dimethyl substitutions on the benzene ring may influence its steric and electronic properties, affecting its reactivity and interactions with other molecules. Overall, this compound's unique combination of functional groups makes it a subject of interest in chemical research and applications.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-7-3-4-8(2)9(5-7)10(12)6-11/h3-5,10,12H,6,11H2,1-2H3
InChI key:InChIKey=NNWGBFPYKKWOIO-UHFFFAOYSA-N
SMILES:C(CN)(O)C1=C(C)C=CC(C)=C1
Synonyms:- 2-Amino-1-(2,5-dimethylphenyl)ethan-1-ol
- α-(Aminomethyl)-2,5-dimethylbenzenemethanol
- 2-Amino-1-(2,5-dimethyl-phenyl)ethanol
- Benzenemethanol, α-(aminomethyl)-2,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.