CymitQuimica logo

CAS 133562-41-1

:

α-(Aminomethyl)-3-phenoxybenzenemethanol

Description:
α-(Aminomethyl)-3-phenoxybenzenemethanol, identified by its CAS number 133562-41-1, is a chemical compound characterized by its complex structure, which includes an aminomethyl group and a phenoxybenzyl moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the presence of hydroxyl (-OH) and amino (-NH2) functional groups. Its phenoxy group may contribute to hydrophobic characteristics, influencing its overall solubility and reactivity. The compound may also display biological activity, making it of interest in pharmaceutical research and development. Additionally, its structural features suggest potential applications in organic synthesis and as an intermediate in the production of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, including its stability, reactivity under various conditions, and potential applications in various fields.
Formula:C14H15NO2
InChI:InChI=1S/C14H15NO2/c15-10-14(16)11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9,14,16H,10,15H2
InChI key:InChIKey=BJTVAYZPBFANDH-UHFFFAOYSA-N
SMILES:O(C1=CC(C(CN)O)=CC=C1)C2=CC=CC=C2
Synonyms:
  • 2-Amino-1-(3-phenoxyphenyl)ethan-1-ol
  • Benzenemethanol, α-(aminomethyl)-3-phenoxy-
  • α-(Aminomethyl)-3-phenoxybenzenemethanol
  • 2-Amino-1-(3-phenoxyphenyl)ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.