CymitQuimica logo

CAS 13358-76-4

:

5,5-Dimethyl-3-(1-piperidinyl)-2-cyclohexen-1-one

Description:
5,5-Dimethyl-3-(1-piperidinyl)-2-cyclohexen-1-one, with the CAS number 13358-76-4, is an organic compound characterized by its unique bicyclic structure, which includes a cyclohexene ring and a piperidine moiety. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 5-position of the cyclohexene ring enhances its steric properties, influencing its chemical behavior and interactions. The piperidine ring adds basicity and can participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's stability and solubility characteristics can vary based on the solvent and conditions used, which is crucial for its practical applications. Overall, 5,5-Dimethyl-3-(1-piperidinyl)-2-cyclohexen-1-one represents a versatile scaffold for further chemical exploration and development.
Formula:C13H21NO
InChI:InChI=1S/C13H21NO/c1-13(2)9-11(8-12(15)10-13)14-6-4-3-5-7-14/h8H,3-7,9-10H2,1-2H3
InChI key:InChIKey=ZPOZHYJJQWTDJR-UHFFFAOYSA-N
SMILES:CC1(C)CC(=CC(=O)C1)N2CCCCC2
Synonyms:
  • 5,5-Dimethyl-3-(1-piperidinyl)-2-cyclohexen-1-one
  • 2-Cyclohexen-1-one, 5,5-dimethyl-3-piperidino-
  • NSC 96498
  • 2-Cyclohexen-1-one, 5,5-dimethyl-3-(1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.