CAS 133591-38-5
:1,4-dimethyl-6-nitro-9H-carbazole
Description:
1,4-Dimethyl-6-nitro-9H-carbazole is an organic compound characterized by its complex structure, which includes a carbazole core substituted with two methyl groups at the 1 and 4 positions and a nitro group at the 6 position. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic electronics, particularly in the development of organic light-emitting diodes (OLEDs) and organic photovoltaics. The presence of the nitro group enhances its electron-accepting properties, making it useful in various electronic and photonic applications. Additionally, the methyl substitutions can influence the solubility and stability of the compound, affecting its performance in practical applications. As with many nitro-containing compounds, it is essential to handle 1,4-dimethyl-6-nitro-9H-carbazole with care due to potential toxicity and environmental concerns. Overall, its unique structural features contribute to its significance in materials science and organic chemistry research.
Formula:C14H12N2O2
InChI:InChI=1/C14H12N2O2/c1-8-3-4-9(2)14-13(8)11-7-10(16(17)18)5-6-12(11)15-14/h3-7,15H,1-2H3
Synonyms:- 1,4-Dimethyl-6-nitro-9H-carbazole
- 9H-carbazole, 1,4-dimethyl-6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.