CAS 13360-92-4
:Phenyldiphenylphosphinite(Diphenylphosphinicacid phenylester)
Description:
Phenyldiphenylphosphinite, also known as diphenylphosphinic acid phenyl ester, is an organophosphorus compound characterized by its phosphinite functional group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is known for its stability and is often used as a flame retardant and plasticizer in various applications, particularly in polymers. Its chemical structure features a phosphorus atom bonded to two phenyl groups and an oxygen atom, which contributes to its unique reactivity and properties. Phenyldiphenylphosphinite exhibits moderate toxicity and should be handled with care, following appropriate safety protocols. It is soluble in organic solvents, making it versatile for use in chemical synthesis and industrial applications. Additionally, it may participate in various chemical reactions, including oxidation and hydrolysis, which can be relevant in both synthetic and environmental chemistry contexts. Overall, phenyldiphenylphosphinite is a significant compound in the field of organophosphorus chemistry, with applications that leverage its chemical properties.
Formula:C18H15OP
InChI:InChI=1/C18H15OP/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
SMILES:c1ccc(cc1)OP(c1ccccc1)c1ccccc1
Synonyms:- Phenyl diphenylphosphinite (Diphenylphosphinic acid phenyl ester)
- Phenyl Diphenylphosphinite
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenoxydiphenylphosphine
CAS:Formula:C18H15OPPurity:>98.0%(GC)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:278.29Phenoxydiphenylphosphine
CAS:Formula:C18H15OPPurity:95%Color and Shape:LiquidMolecular weight:278.2849Phenoxydiphenylphosphine
CAS:Phenoxydiphenylphosphine
Formula:C18H15OPPurity:98%Color and Shape: colourless liquidMolecular weight:278.28g/molPhenoxydiphenylphosphine
CAS:Formula:C18H15OPPurity:95%Color and Shape:LiquidMolecular weight:278.291Phenoxydiphenylphosphine
CAS:Phenoxydiphenylphosphine is a chiral compound that can reversibly oxidize protonated substrates. It is a synthetic electrochemical probe for oxygen nucleophiles that has been studied extensively. Phenoxydiphenylphosphine is an azide-containing phosphine, which isomerizes to the corresponding tetrahydrothiophene upon exposure to air. This reaction has been shown to be irreversible and kinetically slow. The structural analysis of phenoxydiphenylphosphine has been conducted using X-ray crystallography and nuclear magnetic resonance spectroscopy, which yielded the molecular formula C8H6P2N2O2.
Formula:C18H15OPPurity:Min. 95%Molecular weight:278.28 g/mol




