CAS 133604-67-8

N-(4-Fluorobenzoyl)-N-methylglycine

Description:

N-(4-Fluorobenzoyl)-N-methylglycine, also known by its CAS number 133604-67-8, is an organic compound characterized by the presence of both a fluorobenzoyl group and a methylglycine moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, which is common for many amino acid derivatives. The presence of the fluorine atom in the para position of the benzoyl group can influence its electronic properties, potentially enhancing its reactivity and biological activity. As a derivative of glycine, it retains the amino acid's basic structure, which may contribute to its interactions in biological systems. This compound is of interest in medicinal chemistry and pharmaceutical research, particularly for its potential applications in drug development and as a biochemical probe. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and may vary based on purity and environmental conditions.

Formula: C₁₀H₁₀FNO₃

InChI: InChI=1S/C10H10FNO3/c1-12(6-9(13)14)10(15)7-2-4-8(11)5-3-7/h2-5H,6H2,1H3,(H,13,14)

InChI key: InChIKey=YSKWGOCVDOEFKF-UHFFFAOYSA-N

SMILES: C(N(CC(O)=O)C)(=O)C1=CC=C(F)C=C1

Synonyms:

• 2-[1-(4-Fluorophenyl)-N-methylformamido]acetic acid
• N-(4-Fluorobenzoyl)-N-methylglycine
• Glycine, N-(4-fluorobenzoyl)-N-methyl-
• 2-(4-Fluoro-N-methylbenzamido)acetic acid

2-[1-(4-Fluorophenyl)-N-methylformamido]acetic acid

CAS: 133604-67-8

Versatile small molecule scaffold

Formula: C₁₀H₁₀FNO₃

Purity: Min. 95%

Molecular weight: 211.19 g/mol

Ref: 3D-IFA60467