CAS 13361-34-7: Acetic acid, 2-cyano-, 2-ethylhexyl ester
Description:Acetic acid, 2-cyano-, 2-ethylhexyl ester, also known by its CAS number 13361-34-7, is an organic compound characterized by its ester functional group. This substance features a cyano group (-CN) attached to the acetic acid moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 2-ethylhexyl group enhances its hydrophobic properties, making it more soluble in organic solvents than in water. Typically, esters like this compound are known for their fruity odors and are often used in flavoring and fragrance applications. Additionally, the cyano group can impart unique chemical properties, such as increased polarity and the ability to participate in nucleophilic reactions. This compound may also exhibit moderate toxicity, necessitating careful handling and storage. Its applications can extend to the fields of plastics, coatings, and as intermediates in chemical synthesis. Overall, acetic acid, 2-cyano-, 2-ethylhexyl ester is a versatile compound with significant industrial relevance.
Formula:C11H19NO2
InChI:InChI=1S/C11H19NO2/c1-3-5-6-10(4-2)9-14-11(13)7-8-12/h10H,3-7,9H2,1-2H3
InChI key:InChIKey=ZNYBQVBNSXLZNI-UHFFFAOYSA-N
SMILES:N#CCC(=O)OCC(CC)CCCC
- Synonyms:
- (2R)-2-ethylhexyl cyanoacetate
- (2S)-2-ethylhexyl cyanoacetate
- 2-Ethylhexyl 2-cyanoacetate
- 2-Ethylhexyl cyanoacetate
- Acetic acid, cyano-, 2-ethylhexyl ester
- Ai3-07380
- Cyanoacetic acid, 2-ethylhexyl ester
- Nsc 69963
- Acetic acid, 2-cyano-, 2-ethylhexyl ester
