CAS 13361-35-8
:2-methylpropyl chloroacetate
Description:
2-Methylpropyl chloroacetate, with the CAS number 13361-35-8, is an organic compound that belongs to the class of chloroacetates. It is characterized by the presence of a chloroacetate functional group, which consists of a chloro group attached to an acetate moiety. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is moderately soluble in organic solvents but has limited solubility in water due to its hydrophobic alkyl chain. The presence of the chloro group imparts reactivity, making it useful in various chemical synthesis processes, particularly in the production of esters and other derivatives. 2-Methylpropyl chloroacetate can undergo nucleophilic substitution reactions, where the chlorine atom can be replaced by various nucleophiles. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may be harmful if inhaled or ingested. Overall, its chemical properties and reactivity make it a valuable intermediate in organic synthesis.
Formula:C6H11ClO2
InChI:InChI=1/C6H11ClO2/c1-5(2)4-9-6(8)3-7/h5H,3-4H2,1-2H3
Synonyms:- Isobutyl chloroacetate
- acetic acid, 2-chloro-, 2-methylpropyl ester
- Acetic acid, chloro-, isobutyl ester
- Acetic acid, chloro-, 2-methylpropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
