
CAS 133613-75-9
:4bH-1-Benzopyrano[5′,6′:6,7]indeno[1,2-b]indole-3,4b-diol, 2,3,5,6,6a,7,12,12b,12c,13,14,14a-dodecahydro-2-(1-hydroxy-1-methylethyl)-12b,12c-dimethyl-, 3-acetate, [2S-(2α,3α,4bβ,6aα,12bβ,12cα,14aβ)]-
Description:
The chemical substance known as "4bH-1-Benzopyrano[5′,6′:6,7]indeno[1,2-b]indole-3,4b-diol, 2,3,5,6,6a,7,12,12b,12c,13,14,14a-dodecahydro-2-(1-hydroxy-1-methylethyl)-12b,12c-dimethyl-, 3-acetate, [2S-(2α,3α,4bβ,6aα,12bβ,12cα,14aβ)]" with CAS number 133613-75-9 is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple fused rings. This compound features a benzopyrano-indole framework, indicating potential biological activity, particularly in pharmacology. The presence of hydroxyl and acetate functional groups suggests it may exhibit solubility in organic solvents and could participate in various chemical reactions. Its stereochemistry, denoted by the specific configuration at several chiral centers, implies that it may have distinct biological properties depending on its orientation. Such compounds are often studied for their potential therapeutic effects, including anti-inflammatory or anticancer activities. However, detailed studies on its specific properties, reactivity, and biological effects would be necessary to fully understand its applications and safety profile.
Formula:C29H37NO5
InChI:InChI=1S/C29H37NO5/c1-16(31)34-23-15-20-22(35-25(23)26(2,3)32)11-12-27(4)28(5)17(10-13-29(20,27)33)14-19-18-8-6-7-9-21(18)30-24(19)28/h6-9,15,17,22-23,25,30,32-33H,10-14H2,1-5H3/t17-,22-,23+,25-,27+,28+,29+/m0/s1
InChI key:InChIKey=IMABPJDBODVJSN-HKZMUHMQSA-N
SMILES:C[C@@]12[C@]3(C)[C@](O)(C=4[C@](CC3)(O[C@H]([C@@](C)(C)O)[C@H](OC(C)=O)C4)[H])CC[C@]1(CC5=C2NC=6C5=CC=CC6)[H]
Synonyms:- 4bH-1-Benzopyrano[5′,6′:6,7]indeno[1,2-b]indole-3,4b-diol, 2,3,5,6,6a,7,12,12b,12c,13,14,14a-dodecahydro-2-(1-hydroxy-1-methylethyl)-12b,12c-dimethyl-, 3-acetate, [2S-(2α,3α,4bβ,6aα,12bβ,12cα,14aβ)]-
- O-Acetyl-β-paxitriol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
PC-M5'
CAS:PC-M5' is a natural product that can be used as a reference standard. The CAS number of PC-M5' is 133613-75-9.Formula:C29H37NO5Color and Shape:SolidMolecular weight:479.617
