CymitQuimica logo

CAS 13362-56-6

:

6,7-dimethyl-2,3-diphenylquinoxaline

Description:
6,7-Dimethyl-2,3-diphenylquinoxaline is an organic compound characterized by its quinoxaline core, which consists of a fused bicyclic structure containing two nitrogen atoms. This compound features two methyl groups at the 6 and 7 positions and two phenyl groups at the 2 and 3 positions of the quinoxaline ring. It is typically a solid at room temperature and exhibits a relatively high melting point due to its rigid structure and the presence of multiple aromatic rings, which contribute to its stability and potential for π-π stacking interactions. The compound is often studied for its photophysical properties, making it of interest in fields such as organic electronics and materials science. Its unique structure may also impart specific optical and electronic properties, which can be exploited in applications like fluorescence and as a potential building block in organic synthesis. As with many organic compounds, its solubility can vary depending on the solvent used, and it may exhibit fluorescence under UV light.
Formula:C22H18N2
InChI:InChI=1/C22H18N2/c1-15-13-19-20(14-16(15)2)24-22(18-11-7-4-8-12-18)21(23-19)17-9-5-3-6-10-17/h3-14H,1-2H3
SMILES:Cc1cc2c(cc1C)nc(c1ccccc1)c(c1ccccc1)n2
Synonyms:
  • 2,3-Diphenyl-6,7-dimethylquinoxaline
  • Quinoxaline, 6,7-Dimethyl-2,3-Diphenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.