CAS 13362-80-6

4,8-Dimethylquinoline

Description:

4,8-Dimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that consists of a benzene ring fused to a pyridine ring. This compound features two methyl groups attached to the quinoline structure at the 4 and 8 positions, which influences its chemical properties and reactivity. It is typically a yellowish to brown liquid or solid, depending on the temperature and purity. 4,8-Dimethylquinoline is known for its aromatic properties and can exhibit fluorescence, making it of interest in various applications, including organic synthesis and as a potential fluorescent probe. The compound is moderately soluble in organic solvents and has limited solubility in water. Its chemical behavior is influenced by the presence of the nitrogen atom in the pyridine ring, which can participate in hydrogen bonding and coordination with metal ions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 4,8-Dimethylquinoline is a versatile compound with applications in research and industry.

Formula: C₁₁H₁₁N

InChI: InChI=1S/C11H11N/c1-8-6-7-12-11-9(2)4-3-5-10(8)11/h3-7H,1-2H3

InChI key: InChIKey=DULGUAMZWACUFO-UHFFFAOYSA-N

SMILES: CC=1C2=C(C(C)=CC=C2)N=CC1

Synonyms:

• 4,8-Dimethylquinoline
• Quinoline, 4,8-dimethyl-