CAS 133622-65-8

3-Amino-2,5,6-trifluorobenzoic acid

Description:

3-Amino-2,5,6-trifluorobenzoic acid is an aromatic compound characterized by the presence of an amino group and three fluorine atoms attached to a benzoic acid structure. The amino group (-NH2) is located at the meta position relative to the carboxylic acid (-COOH) group, while the trifluoromethyl substituents are positioned at the 2, 5, and 6 positions on the benzene ring. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. Its trifluoromethyl groups contribute to its unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of fluorine atoms can enhance the compound's lipophilicity and metabolic stability. Additionally, 3-amino-2,5,6-trifluorobenzoic acid may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₇H₃F₃NO₂

InChI: InChI=1/C7H4F3NO2/c8-2-1-3(11)6(10)4(5(2)9)7(12)13/h1H,11H2,(H,12,13)/p-1

SMILES: c1c(c(c(c(c1N)F)C(=O)[O-])F)F

Synonyms:

• 3-Amino-2,5,6-Trifluorobenzoate

3-Amino-2,5,6-trifluorobenzoic acid

CAS: 133622-65-8

Formula: C₇H₄F₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.1074

Ref: IN-DA003IU7

3-Amino-2,5,6-trifluorobenzoic acid

CAS: 133622-65-8

3-Amino-2,5,6-trifluorobenzoic acid

Formula: C₇H₄F₃NO₂

Purity: 98%

Color and Shape: beige solid

Molecular weight: 191.11g/mol

Ref: 54-PC6848

3-Amino-2,5,6-trifluorobenzoic acid

CAS: 133622-65-8

3-Amino-2,5,6-trifluorobenzoic acid is a pharmaceutical agent that can be used in the synthesis of dyestuffs and as a matrix for laser desorption/ionization (LDI) mass spectrometry. 3-Amino-2,5,6-trifluorobenzoic acid has been shown to form crystals that are insoluble in water or organic solvents. The crystal morphology was determined by using XRD and FTIR. 3-Amino-2,5,6-trifluorobenzoic acid also has high concentrations of impurities such as 2,4,6-trichloroaniline and 2-(3,4 dichlorophenyl) ethyl amine.

Formula: C₇H₄F₃NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 191.11 g/mol

Ref: 3D-FA67405

3-Amino-2,5,6-trifluorobenzoic acid

CAS: 133622-65-8

Formula: C₇H₄F₃NO₂

Purity: 95%

Molecular weight: 191.109

Ref: 10-F038283