CAS 133627-24-4
:11-Cyclopropyl-5,11-dihydro-4-(hydroxymethyl)-6H-dipyrido[3,2-b:2′,3′-e][1,4]diazepin-6-one
Description:
11-Cyclopropyl-5,11-dihydro-4-(hydroxymethyl)-6H-dipyrido[3,2-b:2′,3′-e][1,4]diazepin-6-one, with CAS number 133627-24-4, is a complex organic compound characterized by its bicyclic structure, which incorporates both diazepine and pyridine moieties. This compound features a cyclopropyl group, contributing to its unique steric and electronic properties. The presence of a hydroxymethyl group enhances its potential for hydrogen bonding, which may influence its solubility and reactivity. The overall structure suggests potential biological activity, possibly as a pharmacological agent, given the presence of nitrogen-containing rings that are often associated with medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its properties can be further explored through spectroscopic methods such as NMR and mass spectrometry. The compound's specific applications and interactions would depend on ongoing research, particularly in the fields of medicinal chemistry and drug development.
Formula:C15H14N4O2
InChI:InChI=1/C15H14N4O2/c20-8-9-5-7-17-14-12(9)18-15(21)11-2-1-6-16-13(11)19(14)10-3-4-10/h1-2,5-7,10,20H,3-4,8H2,(H,18,21)
InChI key:InChIKey=SEBABOMFNCVZGF-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(N(C=3C(C(=O)N2)=CC=CN3)C4CC4)=NC=C1
Synonyms:- 11-Cyclopropyl-5,11-dihydro-4-(hydroxymethyl)-6H-dipyrido[3,2-b:2′,3′-e][1,4]diazepin-6-one
- 12-Hydroxy nevirapine
- 6H-Dipyrido[3,2-b:2′,3′-e][1,4]diazepin-6-one, 11-cyclopropyl-5,11-dihydro-4-(hydroxymethyl)-
- 6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one, 11-cyclopropyl-5,11-dihydro-4-(hydroxymethyl)-
- 11-cyclopropyl-4-(hydroxymethyl)-5H-dipyrido[2,3-e:2',3'-f][1,4]diazepin-6-one
- N11-Cyclopropyl-4-hydroxymethyl-5,11-dihydro-6H-dipyrido(3,2-b:2,3-e)(1,4)diazepin-6-one
- 11-Cyclopropyl-5,11-dihydro-4-(hydroxyMethyl)-6H-dipyrido[3,2-b:2',3'-e][1,4]
- 12-Hydroxy Nevirapine D4
- 12-Hydroxy Nevirapine D7
- 11-Cyclopropyl-5,11-dihydro-4-(hydroxymethyl)-6H-dipyrido[3,2-b:2,3-e][1,4]\ndiazepin-6-one
- 12-Hydroxy NevirapineQ: What is
- 12-Hydroxy Nevirapine Q: What is the CAS Number of
- diazepin-6-one
- Nevirapine 12-Hydroxy
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
12-Hydroxynevirapine
CAS:<p>12-Hydroxynevirapine, major Nevirapine metabolite; non-toxic but liver/skin SULTs convert it to reactive 12-Sulphoxy-nevirapine.</p>Formula:C15H14N4O2Color and Shape:SolidMolecular weight:282.311-Cyclopropyl-5,11-dihydro-4-(hydroxymethyl)-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one
CAS:Controlled ProductFormula:C15H14N4O2Color and Shape:NeatMolecular weight:282.3


