CAS 133627-45-9
:3-amino-2-chloro-4-methylpyridine
Description:
3-Amino-2-chloro-4-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with an amino group, a chlorine atom, and a methyl group. The presence of the amino group (-NH2) contributes to its basicity and potential reactivity, making it a useful intermediate in organic synthesis. The chlorine atom introduces electrophilic characteristics, allowing for further substitution reactions. The methyl group enhances the lipophilicity of the molecule, which can influence its solubility and biological activity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its applications can range from pharmaceuticals to agrochemicals, where it may serve as a building block for more complex molecules. Additionally, the specific arrangement of substituents on the pyridine ring can affect its electronic properties and reactivity, making it a subject of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H7ClN2
InChI:InChI=1S/C6H7ClN2/c1-4-2-3-9-6(7)5(4)8/h2-3H,8H2,1H3
InChI key:InChIKey=UOBCYTOUXLAABU-UHFFFAOYSA-N
SMILES:NC=1C(C)=CC=NC1Cl
Synonyms:- 2-Chloro-3-Amino-4-Methylpyridine
- 2-Chloro-3-amino-4-methyl pyridine
- 2-Chloro-4-Methylpyridin-3-Amine
- 2-Chloro-4-methyl-3-pyridinamine
- 3-Amino-2-Chloro-4-Methylpyridine
- 3-Chloro-2-Methylpyridin-4-Amine
- 3-Pyridinamine, 2-chloro-4-methyl-
- Capic
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Amino-2-chloro-4-methylpyridine
CAS:Formula:C6H7ClN2Purity:>98.0%(GC)(T)Color and Shape:White to Brown powder to crystallineMolecular weight:142.592-chloro-4-methylpyridin-3-amine
CAS:Formula:C6H7ClN2Purity:95%Color and Shape:SolidMolecular weight:142.58623-Amino-2-chloro-4-methylpyridine
CAS:3-Amino-2-chloro-4-methylpyridineFormula:C6H7ClN2Purity:≥95%Color and Shape: beige/brown crystalline solidMolecular weight:142.59g/mol3-Amino-2-chloro-4-methylpyridine
CAS:3-Amino-2-chloro-4-methylpyridine is an impurity that can be found in the synthesis of 3,5-diaminopyridine. The scalable synthesis of this compound is achieved by reacting 2,4-dimethylpyridine with chloroacetyl chloride and ammonia, followed by hydrolysis with hydrochloric acid. 3-Amino-2-chloro-4-methylpyridine has been shown to have antiproliferation activity against human immunodeficiency virus (HIV) and hypersil c18 chromatography. It also has a functional theory for the reaction between 3,5 diaminopyridine and n,n dimethylformamide which leads to a β unsaturated ketone.Formula:C6H7ClN2Purity:Min. 95%Color and Shape:PowderMolecular weight:142.59 g/mol3-Amino-2-chloro-4-methylpyridine
CAS:Formula:C6H7ClN2Purity:95%Color and Shape:Crystalline PowderMolecular weight:142.593-Amino-2-chloro-4-methylpyridine
CAS:Controlled ProductApplications 3-Amino-2-chloro-4-methylpyridine (cas# 133627-45-9) is a compound useful in organic synthesis.
References Ouyang, G., et al.: Molecules, 10, 1351 (2005),Formula:C6H7ClN2Color and Shape:NeatMolecular weight:142.59







