CAS 133627-46-0: 2-Chloro-N-(2-chloro-4-methyl-3-pyridinyl)-3-pyridinecarboxamide
Description:2-Chloro-N-(2-chloro-4-methyl-3-pyridinyl)-3-pyridinecarboxamide, with the CAS number 133627-46-0, is a chemical compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This substance features a pyridine backbone, which is a six-membered aromatic ring containing nitrogen, contributing to its potential biological activity. The presence of chloro groups indicates that it may exhibit specific reactivity and solubility properties, often influencing its interaction with biological targets. The carboxamide functional group suggests potential for hydrogen bonding, which can enhance its solubility in polar solvents and affect its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions to determine its suitability for specific applications.
Formula:C12H9Cl2N3O
InChI:InChI=1S/C12H9Cl2N3O/c1-7-4-6-16-11(14)9(7)17-12(18)8-3-2-5-15-10(8)13/h2-6H,1H3,(H,17,18)
InChI key:InChIKey=UVCHGYJPZGYMSW-UHFFFAOYSA-N
SMILES:O=C(NC=1C(Cl)=NC=CC1C)C2=CC=CN=C2Cl
- Synonyms:
- 1,3-Isobenzofurandione, 5-Methoxy-
- 2-Chloro-N-(2-Chloro-4-Methylpyridin-3-Yl)Nicotinamide
- 2-Chloro-N-(2-chloro-4-methyl-3-pyridinyl)-3-pyridine carboxamide
- 2-Chloro-N-(2-chloro-4-methyl-3-pyridinyl)-3-pyridinecarboxamide
- 2-Chloro-N-(2-chloro-4-methyl-3-pyridyl)-3-pyridine carboxamide
- 2-chloro-N-(2-chloro-4-methylpyridin-3-yl)pyridine-3-carboxamide
- 3-Pyridinecarboxamide, 2-chloro-N-(2-chloro-4-methyl-3-pyridinyl)-
- 5-Methoxy-2-benzofuran-1,3-dion
- 5-Methoxy-2-benzofuran-1,3-dione
- Picnic
- See more synonyms

2-Chloro-N-(2-chloro-4-methyl-3-pyridyl)nicotinamide
Ref: 3B-C3241
5g | 92.00 € | ||
25g | 288.00 € |

2-Chloro-N-(2-chloro-4-methylpyridin-3-yl)nicotinamide
Ref: IN-DA009A8F
1g | 51.00 € | ||
5g | 100.00 € |

2-Chloro-N-(2-chloro-4-methylpyridin-3-yl)nicotinamide
Ref: 54-OR1063172
1g | 43.00 € | ||
5g | 65.00 € | ||
25g | 233.00 € |

2-Chloro-N-(2-chloro-4-methyl-3-pyridinyl)-3-pyridinecarboxamide
Controlled ProductRef: 86-MM1146.05
25mg | To inquire | ||
100mg | To inquire |

2-Chloro-N-(2-chloro-4-methylpyridin-3-yl)nicotinamide
Ref: 10-F214754
25g | To inquire |

Ref: ST-EA-CP-N49008
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |