CAS 13365-26-9: 1,2-Benzenedicarboxylic acid, 3-nitro-, 1,2-dimethyl ester
Description:1,2-Benzenedicarboxylic acid, 3-nitro-, 1,2-dimethyl ester, commonly known as dimethyl 3-nitrophthalate, is an organic compound characterized by its structure, which includes two carboxylate ester groups and a nitro substituent on a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The presence of the nitro group contributes to its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of dyes and pharmaceuticals. Additionally, its ester groups can undergo hydrolysis, making it relevant in studies of environmental degradation. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 1,2-Benzenedicarboxylic acid, 3-nitro-, 1,2-dimethyl ester is a significant compound in organic chemistry with various industrial applications.
Formula:C10H9NO6
InChI:InChI=1S/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3
InChI key:InChIKey=MLQMIKSBTAZNBK-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=CC(=C1C(=O)OC)N(=O)=O
- Synonyms:
- 1,2-Benzenedicarboxylic acid, 3-nitro-, 1,2-dimethyl ester
- 1,2-Benzenedicarboxylic acid, 3-nitro-, dimethyl ester
- 1,2-Dimethyl 3-nitrobenzene-1,2-dicarboxylate
- 3-Nitrophthalic acid dimethyl ester
- Dimethyl 3-Nitrobenzene-1,2-Dicarboxylate
- Methyl 2-(methoxycarbonyl)-3-nitrobenzoate
- NSC 68806
- Phthalic acid, 3-nitro-, dimethyl ester
- Dimethyl 3-nitrophthalate
