CAS 13365-37-2
:9-(3′-Dimethylaminopropylamino)acridine
Description:
9-(3′-Dimethylaminopropylamino)acridine, identified by its CAS number 13365-37-2, is a chemical compound that belongs to the acridine family, which is characterized by a fused three-ring structure containing nitrogen. This compound features a dimethylaminopropylamino side chain, which enhances its solubility and potential biological activity. It is often studied for its properties as a fluorescent dye and its applications in molecular biology, particularly in the context of nucleic acid interactions. The presence of the dimethylamino group contributes to its basicity, allowing it to interact with various biological molecules. Additionally, acridine derivatives are known for their potential use in photodynamic therapy and as intercalating agents in DNA, which can influence genetic processes. The compound's unique structure and functional groups make it a subject of interest in medicinal chemistry and biochemistry, where it may exhibit various pharmacological effects. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with acridine derivatives.
Formula:C18H21N3
InChI:InChI=1S/C18H21N3/c1-21(2)13-7-12-19-18-14-8-3-5-10-16(14)20-17-11-6-4-9-15(17)18/h3-6,8-11H,7,12-13H2,1-2H3,(H,19,20)
InChI key:InChIKey=VJGUBCUGFXDMEX-UHFFFAOYSA-N
SMILES:N(CCCN(C)C)C=1C2=C(N=C3C1C=CC=C3)C=CC=C2
Synonyms:- N'-9-Acridinyl-N,N-dimethyl-1,3-propanediamine
- N'-(acridin-9-yl)-N,N-dimethylpropane-1,3-diamine
- 9-(3'-Dimethylaminopropylamino)acridine
- N3-9-Acridinyl-N1,N1-dimethyl-1,3-propanediamine
- 9-[[3-(Dimethylamino)propyl]amino]acridine
- Acridine, 9-[[3-(dimethylamino)propyl]amino]-
- 9-((3-Dimethylaminopropyl)amino)acridine
- BRN 0485893
- 1,3-Propanediamine, N′-9-acridinyl-N,N-dimethyl-
- 1,3-Propanediamine, N3-9-acridinyl-N1,N1-dimethyl-
- Acridine, 9-(3-(dimethylamino)propylamino)-
- N'-(acridin-9-yl)-N,N-dimethylpropane-1,3-diaminium dichloride
- 1,3-Propanediamine, N'-9-acridinyl-N,N-dimethyl- (9CI)
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.