CAS 13365-63-4
:Methanone, (4-chlorophenyl)-2-furanyl-
Description:
Methanone, (4-chlorophenyl)-2-furanyl- is an organic compound characterized by its unique structure, which includes a furan ring and a chlorophenyl group. The presence of the furan moiety contributes to its aromatic properties, while the chlorophenyl group enhances its reactivity and potential for various chemical interactions. This compound typically exhibits moderate solubility in organic solvents, reflecting its non-polar characteristics due to the aromatic rings. It may also display biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of more complex molecules. Additionally, the presence of the chlorine atom can influence its electronic properties, potentially affecting its reactivity and interaction with other chemical species. Safety data should be consulted for handling and storage, as compounds with halogen substituents can exhibit varying degrees of toxicity and environmental impact. Overall, Methanone, (4-chlorophenyl)-2-furanyl- is a compound of interest in both synthetic and medicinal chemistry.
Formula:C11H7ClO2
InChI:InChI=1S/C11H7ClO2/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H
InChI key:QIYZYIJVBGPXKW-UHFFFAOYSA-N
SMILES:C1=COC(=C1)C(=O)C2=CC=C(C=C2)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery