CAS 133659-66-2

1-[2-(Dimethylamino)-5-nitrophenyl]ethanone

Description:

1-[2-(Dimethylamino)-5-nitrophenyl]ethanone, with the CAS number 133659-66-2, is an organic compound characterized by its distinct functional groups and structural features. It contains a ketone functional group, indicated by the ethanone moiety, and a nitrophenyl group, which contributes to its potential reactivity and applications in various chemical processes. The presence of the dimethylamino group suggests that the compound may exhibit basic properties and could participate in nucleophilic reactions. This compound is likely to be a yellow to orange solid, reflecting the influence of the nitro group on its electronic structure and color. Its molecular structure may confer specific biological activities, making it of interest in medicinal chemistry or as a dye. Additionally, the compound's solubility, stability, and reactivity can be influenced by the surrounding environment, including pH and solvent polarity. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity associated with the nitro and amine groups.

Formula: C₁₀H₁₂N₂O₃

InChI: InChI=1S/C10H12N2O3/c1-7(13)9-6-8(12(14)15)4-5-10(9)11(2)3/h4-6H,1-3H3

InChI key: InChIKey=HAULHUKZHBBGEM-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(N(C)C)C=CC(N(=O)=O)=C1

Synonyms:

• Ethanone, 1-[2-(dimethylamino)-5-nitrophenyl]-
• 1-[2-(Dimethylamino)-5-nitrophenyl]ethanone
• 2-Acetyl-4-nitro-N,N-dimethylaniline
• 1-[2-(Dimethylamino)-5-nitrophenyl]ethan-1-one