CAS 133662-28-9

2-(1H-Pyrrol-1-yl)benzoyl chloride

Description:

2-(1H-Pyrrol-1-yl)benzoyl chloride, with the CAS number 133662-28-9, is an organic compound characterized by the presence of both a pyrrole and a benzoyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The pyrrole moiety contributes to its aromatic character and can influence its reactivity and solubility in various solvents. This compound is often utilized in organic synthesis, particularly in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential, as it can be corrosive and may react with water, releasing hydrochloric acid.

Formula: C₁₁H₈ClNO

InChI: InChI=1S/C11H8ClNO/c12-11(14)9-5-1-2-6-10(9)13-7-3-4-8-13/h1-8H

InChI key: InChIKey=MDEJNSHSQYMKEB-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=C(C=CC=C1)N2C=CC=C2

Synonyms:

• 2-(1H-Pyrrol-1-yl)benzoyl chloride
• Benzoyl chloride, 2-(1H-pyrrol-1-yl)-